4,4-bis(ethylsulfonyl)butylbenzene structure
|
Common Name | 4,4-bis(ethylsulfonyl)butylbenzene | ||
|---|---|---|---|---|
| CAS Number | 6331-49-3 | Molecular Weight | 318.45200 | |
| Density | 1.207g/cm3 | Boiling Point | 573.8ºC at 760 mmHg | |
| Molecular Formula | C14H22O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.9ºC | |
| Name | 4,4-bis(ethylsulfonyl)butylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 573.8ºC at 760 mmHg |
| Molecular Formula | C14H22O4S2 |
| Molecular Weight | 318.45200 |
| Flash Point | 377.9ºC |
| Exact Mass | 318.09600 |
| PSA | 85.04000 |
| LogP | 4.36640 |
| Index of Refraction | 1.529 |
| InChIKey | KLHRERFWXNEEAA-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(CCCc1ccccc1)S(=O)(=O)CC |
|
~%
4,4-bis(ethylsu... CAS#:6331-49-3 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
|
~%
4,4-bis(ethylsu... CAS#:6331-49-3 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1-Bis-aethansulfonyl-4-phenyl-butan |
| 1,1-bis-ethanesulfonyl-3-phenyl-propane |
| 1,1-Bis-aethansulfonyl-3-phenyl-propan |
| 1,1-bis-ethanesulfonyl-4-phenyl-butane |