2-cyclohexylguanidine,sulfuric acid structure
|
Common Name | 2-cyclohexylguanidine,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 6331-57-3 | Molecular Weight | 239.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H17N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexylguanidine,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H17N3O4S |
|---|---|
| Molecular Weight | 239.29300 |
| Exact Mass | 239.09400 |
| PSA | 144.88000 |
| LogP | 2.42110 |
| InChIKey | UOXLWSZDBMDIMH-UHFFFAOYSA-N |
| SMILES | NC(N)=NC1CCCCC1.NC(N)=NC1CCCCC1.O=S(=O)(O)O |
|
~92%
2-cyclohexylgua... CAS#:6331-57-3 |
| Literature: Russ; Ried; Ullrich; Mutschler Archiv der Pharmazie, 1992 , vol. 325, # 12 p. 761 - 767 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| cyclohexyl-guanidine,sulfate |
| Cyclohexyl-guanidin,Sulfat |