Benzenesulfonamide,3-nitro-N-9H-xanthen-9-yl
Benzenesulfonamide,3-nitro-N-9H-xanthen-9-yl structure
|
Common Name | Benzenesulfonamide,3-nitro-N-9H-xanthen-9-yl | ||
|---|---|---|---|---|
| CAS Number | 6331-75-5 | Molecular Weight | 382.39000 | |
| Density | 1.51g/cm3 | Boiling Point | 558.7ºC at 760mmHg | |
| Molecular Formula | C19H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-nitro-benzenesulfonic acid sec-butylamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 558.7ºC at 760mmHg |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.39000 |
| Flash Point | 291.7ºC |
| Exact Mass | 382.06200 |
| PSA | 109.60000 |
| LogP | 5.76330 |
| Index of Refraction | 1.715 |
| InChIKey | RLCOQUABONVTIV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzenesulfonam... CAS#:6331-75-5 |
| Literature: Sawicki; Oliverio Journal of Organic Chemistry, 1956 , vol. 21, p. 183,186, 188 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-nitro-benzenesulfonic acid xanthen-9-ylamide |
| 3-Nitro-benzolsulfonsaeure-xanthen-9-ylamid |
| 3-Nitro-benzolsulfonsaeure-sec-butylamid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: Molecular formula of 3-nitro-benzenesulfonic acid sec-butylamide is C19H14N2O5S. |
| Q: What is the InChIKey of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: InChIKey of 3-nitro-benzenesulfonic acid sec-butylamide is RLCOQUABONVTIV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: Molecular weight of 3-nitro-benzenesulfonic acid sec-butylamide is 382.39000. |
| Q: What is the Chinese name of 6331-75-5? |
| A: Chinese name of 6331-75-5 is 6331-75-5. |
| Q: What is the CAS number of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: CAS number of 3-nitro-benzenesulfonic acid sec-butylamide is 6331-75-5. |
| Q: What is the LogP of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: LogP of 3-nitro-benzenesulfonic acid sec-butylamide is 5.76330. |
| Q: What is the SMILES notation of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: SMILES notation of 3-nitro-benzenesulfonic acid sec-butylamide is O=[N+]([O-])c1cccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c1. |
| Q: What is the polar surface area (PSA) of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: Polar surface area (PSA) of 3-nitro-benzenesulfonic acid sec-butylamide is 109.60000. |
| Q: What is the English name of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: The English name of 3-nitro-benzenesulfonic acid sec-butylamide is 3-nitro-benzenesulfonic acid sec-butylamide. |
| Q: What are the upstream materials of 3-nitro-benzenesulfonic acid sec-butylamide? |
| A: Related upstream materials(CAS) of 3-nitro-benzenesulfonic acid sec-butylamide: 90-46-0;121-52-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |