Benzenesulfonamide,3-nitro-N-9H-xanthen-9-yl structure
|
Common Name | Benzenesulfonamide,3-nitro-N-9H-xanthen-9-yl | ||
|---|---|---|---|---|
| CAS Number | 6331-75-5 | Molecular Weight | 382.39000 | |
| Density | 1.51g/cm3 | Boiling Point | 558.7ºC at 760mmHg | |
| Molecular Formula | C19H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.7ºC | |
| Name | 3-nitro-benzenesulfonic acid sec-butylamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 558.7ºC at 760mmHg |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.39000 |
| Flash Point | 291.7ºC |
| Exact Mass | 382.06200 |
| PSA | 109.60000 |
| LogP | 5.76330 |
| Index of Refraction | 1.715 |
| InChIKey | RLCOQUABONVTIV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c1 |
|
~%
Benzenesulfonam... CAS#:6331-75-5 |
| Literature: Sawicki; Oliverio Journal of Organic Chemistry, 1956 , vol. 21, p. 183,186, 188 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-nitro-benzenesulfonic acid xanthen-9-ylamide |
| 3-Nitro-benzolsulfonsaeure-xanthen-9-ylamid |
| 3-Nitro-benzolsulfonsaeure-sec-butylamid |