4-(4-METHYLPHENYL)-5-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-(4-METHYLPHENYL)-5-PHENYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 63314-58-9 | Molecular Weight | 267.34900 | |
| Density | 1.23g/cm3 | Boiling Point | 397.2ºC at 760 mmHg | |
| Molecular Formula | C15H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 4-(4-methylphenyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760 mmHg |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.34900 |
| Flash Point | 194ºC |
| Exact Mass | 267.08300 |
| PSA | 69.51000 |
| LogP | 3.53140 |
| Index of Refraction | 1.673 |
| InChIKey | KBHKRHWQRBASFL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)n[nH]c2=S)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-methylphenyl)-5-phenyl-4H-1,2,4-triazole-3-thiol |
| 5-Phenyl-4-p-tolyl-4H-[1,2,4]triazole-3-thiol |
| 5-Phenyl-4-p-tolyl-2,4-dihydro-[1,2,4]triazol-3-thion |
| 5-phenyl-4-(p-tolyl)-1,2,4-triazole-3-thione |
| 5-phenyl-4-p-tolyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 4-(4-methylphenyl)-5-phenyl-1,2,4-triazole-3-thiol |