7-methoxy-3-oxo-2,9,10,10a-tetrahydro-1H-phenanthrene-9-carboxylic acid structure
|
Common Name | 7-methoxy-3-oxo-2,9,10,10a-tetrahydro-1H-phenanthrene-9-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6332-21-4 | Molecular Weight | 272.29600 | |
| Density | 1.31g/cm3 | Boiling Point | 507.9ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 7-methoxy-3-oxo-2,9,10,10a-tetrahydro-1H-phenanthrene-9-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 507.9ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 193.1ºC |
| Exact Mass | 272.10500 |
| PSA | 63.60000 |
| LogP | 2.62960 |
| Index of Refraction | 1.61 |
| InChIKey | GTJWJNAJBVXGOW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(C(=O)O)CC1CCC(=O)C=C21 |
|
~%
7-methoxy-3-oxo... CAS#:6332-21-4 |
| Literature: Walker Journal of the American Chemical Society, 1958 , vol. 80, p. 645,649 |
|
~%
7-methoxy-3-oxo... CAS#:6332-21-4 |
| Literature: Walker Journal of the American Chemical Society, 1958 , vol. 80, p. 645,649 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-methoxy-3-oxo-1,2,3,9,10,10a-hexahydro-phenanthrene-9-carboxylic acid |
| 7-Methoxy-3-oxo-1,2,3,9,10,10a-hexahydro-phenanthren-9-carbonsaeure |