2-(1-cyclohexenyl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid structure
|
Common Name | 2-(1-cyclohexenyl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 6332-34-9 | Molecular Weight | 288.33800 | |
| Density | 1.185g/cm3 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | 2-(cyclohexen-1-yl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.33800 |
| Flash Point | 170.1ºC |
| Exact Mass | 288.13600 |
| PSA | 55.76000 |
| LogP | 3.67220 |
| Index of Refraction | 1.589 |
| InChIKey | ZIXPQYBTDBMPGJ-UVTDQMKNSA-N |
| SMILES | COc1ccc(C=C(C(=O)O)C2=CCCCC2)cc1OC |
|
~%
2-(1-cyclohexen... CAS#:6332-34-9 |
| Literature: Schwenk; Papa Journal of the American Chemical Society, 1945 , vol. 67, p. 1432,1434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Cyclohex-1-enyl-2-phenyl-4-piperidino-buttersaeure-amid |
| 2-cyclohex-1-enyl-2-phenyl-4-piperidino-butyric acid amide |
| 2-cyclohex-1-enyl-3-(3,4-dimethoxy-phenyl)-acrylic acid |
| 2-Cyclohex-1-enyl-3-(3,4-dimethoxy-phenyl)-acrylsaeure |