2,8-bis(dimethylaminomethyl)cyclooctan-1-one structure
|
Common Name | 2,8-bis(dimethylaminomethyl)cyclooctan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6333-26-2 | Molecular Weight | 276.84600 | |
| Density | 0.92g/cm3 | Boiling Point | 323ºC at 760 mmHg | |
| Molecular Formula | C14H29ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.1ºC | |
| Name | 2,8-bis[(dimethylamino)methyl]cyclooctan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 323ºC at 760 mmHg |
| Molecular Formula | C14H29ClN2O |
| Molecular Weight | 276.84600 |
| Flash Point | 115.1ºC |
| Exact Mass | 276.19700 |
| PSA | 23.55000 |
| LogP | 2.67720 |
| Index of Refraction | 1.466 |
| InChIKey | WZQKEFKBISEZLU-UHFFFAOYSA-N |
| SMILES | CN(C)CC1CCCCCC(CN(C)C)C1=O.Cl |
|
~42%
2,8-bis(dimethy... CAS#:6333-26-2 |
| Literature: Dimmock, JR; Sidhu, KK; Chen, M; Reid, RS; Allen, TM; et al. European Journal of Medicinal Chemistry, 1993 , vol. 28, # 4 p. 313 - 322 |
|
~16%
2,8-bis(dimethy... CAS#:6333-26-2 |
| Literature: Dimmock; Chamankhah; Seniuk; Allen; Kao; Halleran Pharmazie, 1995 , vol. 50, # 10 p. 668 - 671 |
| 2,8-Bis-dimethylaminomethyl-cyclooctanon,Dihydrochlorid |
| 2,8-bis-dimethylaminomethyl-cyclooctanone,dihydrochloride |
| 2,8-bis-bromomethyl-phenazine |