3-(2,6-dimethoxy-4-methylphenyl)acrylic acid structure
|
Common Name | 3-(2,6-dimethoxy-4-methylphenyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 6334-49-2 | Molecular Weight | 222.23700 | |
| Density | 1.173g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150ºC | |
| Name | 3-(2,6-dimethoxy-4-methylphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 150ºC |
| Exact Mass | 222.08900 |
| PSA | 55.76000 |
| LogP | 2.11000 |
| Index of Refraction | 1.567 |
| InChIKey | XCTXJHNBAGXPMI-SNAWJCMRSA-N |
| SMILES | COc1cc(C)cc(OC)c1C=CC(=O)O |
|
~32%
3-(2,6-dimethox... CAS#:6334-49-2 |
| Literature: Srivastava, Vandana; Darokar, Mahendra P.; Fatima, Atiya; Kumar; Chowdhury, Chinmay; Saxena, Hari Om; Dwivedi, Gaurav R.; Shrivastava, Kunal; Gupta, Vivek; Chattopadhyay; Luqman, Suaib; Gupta; Negi, Arvind S.; Khanuja, Suman P.S. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 1 p. 518 - 525 |
|
~%
3-(2,6-dimethox... CAS#:6334-49-2 |
| Literature: Adams; Carlin Journal of the American Chemical Society, 1943 , vol. 65, p. 360,361 |
|
~%
3-(2,6-dimethox... CAS#:6334-49-2 |
| Literature: Adams; Carlin Journal of the American Chemical Society, 1943 , vol. 65, p. 360,361 |
| 2,6-Dimethoxy-4-methyl-trans-zimtsaeure |
| 3-(2,6-dimethoxy-4-methylphenyl)acrylic acid |
| 2,6-dimethoxy-4-methyl-trans-cinnamic acid |