[1,1'-Biphenyl]-4-aceticacid, a-[1,1'-biphenyl]-4-yl-a-hydroxy
![[1,1'-Biphenyl]-4-aceticacid, a-[1,1'-biphenyl]-4-yl-a-hydroxy Structure](https://image.chemsrc.com/caspic/070/6334-91-4.png)
[1,1'-Biphenyl]-4-aceticacid, a-[1,1'-biphenyl]-4-yl-a-hydroxy structure
|
Common Name | [1,1'-Biphenyl]-4-aceticacid, a-[1,1'-biphenyl]-4-yl-a-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 6334-91-4 | Molecular Weight | 380.43500 | |
| Density | 1.231g/cm3 | Boiling Point | 590.7ºC at 760 mmHg | |
| Molecular Formula | C26H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.1ºC | |
| Name | 2-hydroxy-2,2-bis(4-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 590.7ºC at 760 mmHg |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.43500 |
| Flash Point | 325.1ºC |
| Exact Mass | 380.14100 |
| PSA | 57.53000 |
| LogP | 5.34110 |
| Index of Refraction | 1.645 |
| InChIKey | ZAINQWJQOUCQDK-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918199090 |
|---|
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Bachmann; Sternberger Journal of the American Chemical Society, 1934 , vol. 56, p. 170,171 |
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Silver; Lowy Journal of the American Chemical Society, 1934 , vol. 56, p. 2429 |
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Gomberg; van Natta Journal of the American Chemical Society, 1929 , vol. 51, p. 2243 |
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Gomberg; van Natta Journal of the American Chemical Society, 1929 , vol. 51, p. 2243 |
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Schlenk; Appenrodt; Michael; Thal Chemische Berichte, 1914 , vol. 47, p. 477 |
|
~%
[1,1'-Biphenyl]... CAS#:6334-91-4 |
| Literature: Schlenk; Appenrodt; Michael; Thal Chemische Berichte, 1914 , vol. 47, p. 477 |
![Methanone,bis([1,1'-biphenyl]-4-yl) structure](https://image.chemsrc.com/caspic/073/3478-90-8.png)
![N-[2-(2,4-dimethoxyphenyl)ethyl]adamantane-1-carboxamide structure](https://image.chemsrc.com/caspic/219/5623-25-6.png)
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
| Bis-p-diphenylyl-glykolsaeure |
| Bis-diphenylyl-glykolsaeure |
| 4,4'-diphenyl-benzilic acid |
| Hydroxy-bis-(biphenylyl-(4))-essigsaeure |
| dibiphenyl-4-yl(hydroxy)acetic acid |
| 4,4'-Diphenyl-benzilsaeure |
| 1-Oxy-bis-diphenylyl-essigsaeure |