7-methoxy-1-methyl-2,3,10,11-tetrahydronaphtho[2,1-e]phosphindole 1-oxide structure
|
Common Name | 7-methoxy-1-methyl-2,3,10,11-tetrahydronaphtho[2,1-e]phosphindole 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 63347-72-8 | Molecular Weight | 298.31600 | |
| Density | 1.23g/cm3 | Boiling Point | 555.7ºC at 760 mmHg | |
| Molecular Formula | C18H19O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.8ºC | |
| Name | 7-methoxy-1-methyl-2,3,10,11-tetrahydronaphtho[2,1-e]phosphindole 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 555.7ºC at 760 mmHg |
| Molecular Formula | C18H19O2P |
| Molecular Weight | 298.31600 |
| Flash Point | 302.8ºC |
| Exact Mass | 298.11200 |
| PSA | 36.11000 |
| LogP | 4.90230 |
| Index of Refraction | 1.623 |
| InChIKey | YNGNOICYYXRCQT-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3c(ccc2c1)C1=C(CC3)P(C)(=O)CC1 |
|
~%
7-methoxy-1-met... CAS#:63347-72-8 |
| Literature: Symmes,C.; Quin,L.D. Journal of Organic Chemistry, 1979 , vol. 44, p. 1048 - 1056 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7-methoxy-1-methyl-2,3,10,11-tetrahydro-1H-naphtho[2,1-e]phosphindole 1-oxide |
| 7-Methoxy-1-methyl-2,3,10,11-tetrahydro-1H-naphtho<2,1-e>phosphindol-1-oxid |