4,7-dipropanoyloxyheptyl propanoate structure
|
Common Name | 4,7-dipropanoyloxyheptyl propanoate | ||
|---|---|---|---|---|
| CAS Number | 6335-11-1 | Molecular Weight | 316.39000 | |
| Density | 1.042g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C16H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | 4,7-di(propanoyloxy)heptyl propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39000 |
| Flash Point | 167.6ºC |
| Exact Mass | 316.18900 |
| PSA | 78.90000 |
| LogP | 2.77500 |
| Index of Refraction | 1.449 |
| InChIKey | KTHPWGNIDCEZKF-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCCCC(CCCOC(=O)CC)OC(=O)CC |
|
~%
4,7-dipropanoyl... CAS#:6335-11-1 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4,7-tris-propionyloxy-heptane |
| heptane-1,4,7-triyl tripropanoate |