4-bromo-N-(2-chlorophenyl)benzenesulfonamide structure
|
Common Name | 4-bromo-N-(2-chlorophenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6335-29-1 | Molecular Weight | 346.62700 | |
| Density | 1.677g/cm3 | Boiling Point | 440.5ºC at 760 mmHg | |
| Molecular Formula | C12H9BrClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | 4-bromo-N-(2-chlorophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.677g/cm3 |
|---|---|
| Boiling Point | 440.5ºC at 760 mmHg |
| Molecular Formula | C12H9BrClNO2S |
| Molecular Weight | 346.62700 |
| Flash Point | 220.2ºC |
| Exact Mass | 344.92300 |
| PSA | 54.55000 |
| LogP | 5.05710 |
| Index of Refraction | 1.661 |
| InChIKey | YZRTXPOHUIZHPI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1ccccc1Cl)c1ccc(Br)cc1 |
|
~%
4-bromo-N-(2-ch... CAS#:6335-29-1 |
| Literature: Marvel; Smith Journal of the American Chemical Society, 1923 , vol. 45, p. 2697 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| benzenesulfonamide,4-bromo-n-(2-chlorophenyl) |
| 4-Brom-benzolsulfonsaeure-(2-chlor-anilid) |
| 4-bromo-benzenesulfonic acid-(2-chloro-anilide) |