ethyl 3-hydroxy-3-methyl-2-phenyl-butanoate structure
|
Common Name | ethyl 3-hydroxy-3-methyl-2-phenyl-butanoate | ||
|---|---|---|---|---|
| CAS Number | 6335-79-1 | Molecular Weight | 222.28000 | |
| Density | 1.076g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | ethyl 3-hydroxy-3-methyl-2-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 134.7ºC |
| Exact Mass | 222.12600 |
| PSA | 46.53000 |
| LogP | 2.10420 |
| Index of Refraction | 1.514 |
| InChIKey | HIMQJWDCEZNEAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(c1ccccc1)C(C)(C)O |
|
~%
ethyl 3-hydroxy... CAS#:6335-79-1 |
| Literature: Farkas,J.; Novak,J.J.K. Collection of Czechoslovak Chemical Communications, 1960 , vol. 25, p. 1815 - 1823 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| (+-)-3-hydroxy-3-methyl-2-phenyl-butyric acid ethyl ester |
| 3-Hydroxy-3-methyl-2-phenyl-buttersaeure-aethylester |
| 3-Hydroxy-3-methyl-2-phenyl-buttersaeure-ethylester |
| 3-Hydroxy-2-phenyl-isovaleriansaeure-aethylester |