2,4(1H,3H)-Pyrimidinedione,6-amino-5-[2-(4-chlorophenyl)diazenyl]-1,3-dimethyl- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-amino-5-[2-(4-chlorophenyl)diazenyl]-1,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 63351-22-4 | Molecular Weight | 293.70900 | |
| Density | 1.47g/cm3 | Boiling Point | 382ºC at 760mmHg | |
| Molecular Formula | C12H12ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.8ºC | |
| Name | (5Z)-5-[(4-chlorophenyl)hydrazinylidene]-6-imino-1,3-dimethyl-1,3-diazinane-2,4-dione |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 382ºC at 760mmHg |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.70900 |
| Flash Point | 184.8ºC |
| Exact Mass | 293.06800 |
| PSA | 94.74000 |
| LogP | 2.31620 |
| Index of Refraction | 1.674 |
| InChIKey | SBVUPRRBCXGKOU-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(N=Nc2ccc(Cl)cc2)c(=O)n(C)c1=O |
|
~97%
2,4(1H,3H)-Pyri... CAS#:63351-22-4 |
| Literature: Yazdanbakhsh, Mohamad-Reza; Abbasnia, Masoumeh; Sheykhan, Mehdi; Ma'Mani, Leila Journal of Molecular Structure, 2010 , vol. 977, # 1-3 p. 266 - 273 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |