(3S)-1-Iodo-3-(tert-butyldimethylsilyloxy)-1-octene structure
|
Common Name | (3S)-1-Iodo-3-(tert-butyldimethylsilyloxy)-1-octene | ||
|---|---|---|---|---|
| CAS Number | 63358-20-3 | Molecular Weight | 368.36900 | |
| Density | 1.17 | Boiling Point | 324.109ºC at 760 mmHg | |
| Molecular Formula | C14H29IOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.816ºC | |
| Name | (3S)-1-Iodo-3-(tert-butyldimethylsilyloxy)-1-octene |
|---|
| Density | 1.17 |
|---|---|
| Boiling Point | 324.109ºC at 760 mmHg |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.36900 |
| Flash Point | 149.816ºC |
| Exact Mass | 368.10300 |
| PSA | 9.23000 |
| LogP | 5.90580 |
| Index of Refraction | 1.486 |
| InChIKey | LTLQAJZGKYDIDX-YLSINNKHSA-N |
| SMILES | CCCCCC(C=CI)O[Si](C)(C)C(C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |