N-(6-chloro-9,10-dioxo-anthracen-1-yl)benzamide structure
|
Common Name | N-(6-chloro-9,10-dioxo-anthracen-1-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 6337-17-3 | Molecular Weight | 361.77800 | |
| Density | 1.447g/cm3 | Boiling Point | 506.2ºC at 760 mmHg | |
| Molecular Formula | C21H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | N-(6-chloro-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 506.2ºC at 760 mmHg |
| Molecular Formula | C21H12ClNO3 |
| Molecular Weight | 361.77800 |
| Flash Point | 260ºC |
| Exact Mass | 361.05100 |
| PSA | 63.24000 |
| LogP | 4.44070 |
| Index of Refraction | 1.714 |
| InChIKey | LRZQPQJEYDUCKH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccc(Cl)cc1C2=O)c1ccccc1 |
|
~%
N-(6-chloro-9,1... CAS#:6337-17-3 |
| Literature: Bayer and Co. Patent: DE225232 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Benzoylamino-6-chlor-anthrachinon |
| 1-benzoylamino-6-chloro-anthraquinone |
| 6-Chlor-1-benzamino-anthrachinon |