Benzamide,N-(9,10-dihydro-4-nitro-9,10-dioxo-1-anthracenyl)- structure
|
Common Name | Benzamide,N-(9,10-dihydro-4-nitro-9,10-dioxo-1-anthracenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6337-18-4 | Molecular Weight | 372.33000 | |
| Density | 1.49g/cm3 | Boiling Point | 544.6ºC at 760 mmHg | |
| Molecular Formula | C21H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.1ºC | |
| Name | N-(4-nitro-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 544.6ºC at 760 mmHg |
| Molecular Formula | C21H12N2O5 |
| Molecular Weight | 372.33000 |
| Flash Point | 283.1ºC |
| Exact Mass | 372.07500 |
| PSA | 109.06000 |
| LogP | 4.21870 |
| Index of Refraction | 1.73 |
| InChIKey | BMADYDDHJMMFRL-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c2c1C(=O)c1ccccc1C2=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N-(9,... CAS#:6337-18-4 |
| Literature: Bayer and Co. Patent: DE225232 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Nitro-1-benzamino-anthrachinon |
| 1-Benzoylamino-4-nitro-anthrachinon |
| Benzamide,10-dihydro-4-nitro-9,10-dioxo-1-anthracenyl) |