Ethanone,1-(4-phenoxyphenyl)-, oxime structure
|
Common Name | Ethanone,1-(4-phenoxyphenyl)-, oxime | ||
|---|---|---|---|---|
| CAS Number | 6337-25-3 | Molecular Weight | 227.25900 | |
| Density | 1.08g/cm3 | Boiling Point | 364ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | N-[1-(4-phenoxyphenyl)ethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 364ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 174ºC |
| Exact Mass | 227.09500 |
| PSA | 41.82000 |
| LogP | 3.67710 |
| Index of Refraction | 1.556 |
| InChIKey | JUAZJCZQQVIGSY-RVDMUPIBSA-N |
| SMILES | CC(=NO)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(4-phenoxy-phenyl)-ethanone oxime |
| 1-(4-Phenoxy-phenyl)-aethanon-oxim |