5-phenyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-dione
Modify Date: 2025-09-18 18:06:44
5-phenyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-dione structure
|
Common Name | 5-phenyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6337-27-5 | Molecular Weight | 228.24300 | |
| Density | 1.192g/cm3 | Boiling Point | 487.9ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | 5-phenyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 487.9ºC at 760 mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 248.9ºC |
| Exact Mass | 228.07900 |
| PSA | 43.37000 |
| LogP | 2.17960 |
| Index of Refraction | 1.598 |
| InChIKey | JKYWPOLMZPJQML-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2CC(c3ccccc3)=CCC12 |
| maleic anhydride adduct of 2-Phenyl-1,3-butadien |
| 5-phenyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-dione |
| Maleic-anhydride of 2-Phenyl-1,3-butadione |
| 4-Phenylcyclohex-4-ene-1,2-carboxylic anhydride |