Ethanone,2-bromo-1-(8-chloro-2-phenyl-4-quinolinyl)- structure
|
Common Name | Ethanone,2-bromo-1-(8-chloro-2-phenyl-4-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 6338-21-2 | Molecular Weight | 360.63200 | |
| Density | 1.51g/cm3 | Boiling Point | 504.7ºC at 760mmHg | |
| Molecular Formula | C17H11BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259ºC | |
| Name | 2-bromo-1-(8-chloro-2-phenylquinolin-4-yl)ethanone |
|---|
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 504.7ºC at 760mmHg |
| Molecular Formula | C17H11BrClNO |
| Molecular Weight | 360.63200 |
| Flash Point | 259ºC |
| Exact Mass | 358.97100 |
| PSA | 29.96000 |
| LogP | 5.13280 |
| Index of Refraction | 1.672 |
| InChIKey | XAYZEHQNQBUPDM-UHFFFAOYSA-N |
| SMILES | O=C(CBr)c1cc(-c2ccccc2)nc2c(Cl)cccc12 |
|
~%
Ethanone,2-brom... CAS#:6338-21-2 |
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1810 |
|
~%
Ethanone,2-brom... CAS#:6338-21-2 |
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1810 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |