Benzeneacetic acid,2-oxo-1,2-diphenylethyl ester structure
|
Common Name | Benzeneacetic acid,2-oxo-1,2-diphenylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6340-81-4 | Molecular Weight | 330.37700 | |
| Density | 1.181g/cm3 | Boiling Point | 482.2ºC at 760 mmHg | |
| Molecular Formula | C22H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | (2-oxo-1,2-diphenylethyl) 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 482.2ºC at 760 mmHg |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.37700 |
| Flash Point | 211.4ºC |
| Exact Mass | 330.12600 |
| PSA | 43.37000 |
| LogP | 4.39650 |
| Index of Refraction | 1.604 |
| InChIKey | PLDFCWZNPNWKGF-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)OC(C(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~98%
Benzeneacetic a... CAS#:6340-81-4 |
| Literature: Evans, David A.; Nagorny, Pavel; Xu, Risheng Organic Letters, 2006 , vol. 8, # 24 p. 5669 - 5671 |
|
~%
Benzeneacetic a... CAS#:6340-81-4 |
| Literature: Puetter; Dilthey Journal fuer Praktische Chemie (Leipzig), 1938 , vol. <2> 150, p. 40,43 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-oxo-1,2-diphenylethyl phenylacetate |
| 2-oxo-1,2-diphenylethyl 2-phenylacetate |
| Desyl-phenylacetat |