Calcium DL-Pantothenate structure
|
Common Name | Calcium DL-Pantothenate | ||
|---|---|---|---|---|
| CAS Number | 63409-48-3 | Molecular Weight | 476.532 | |
| Density | N/A | Boiling Point | 551.5ºC at 760 mmHg | |
| Molecular Formula | C18H32CaN2O10 | Melting Point | 138ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 287.3ºC | |
Use of Calcium DL-PantothenateVitamin B5,Calcium Salt Hydrate-13C3, 15N is the 13C and 15N labeled Vitamin B5,Calcium Salt Hydrate[1]. |
| Name | DL-Pantothenic Acid Calcium Salt |
|---|---|
| Synonym | More Synonyms |
| Description | Vitamin B5,Calcium Salt Hydrate-13C3, 15N is the 13C and 15N labeled Vitamin B5,Calcium Salt Hydrate[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Boiling Point | 551.5ºC at 760 mmHg |
|---|---|
| Melting Point | 138ºC (dec.)(lit.) |
| Molecular Formula | C18H32CaN2O10 |
| Molecular Weight | 476.532 |
| Flash Point | 287.3ºC |
| Exact Mass | 476.168274 |
| PSA | 191.72000 |
| InChIKey | SYQWOQFFWAJNPD-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)O.O.[Ca] |
| Storage condition | 2-8°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2936240000 |
| HS Code | 2936240000 |
|---|
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
| Calcium Pantothenate, Racemic |
| DL-Pantothenic acid hemicalcium salt |
| Calcium bis{3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoate} |
| DL-Calcium pantothenate |
| Calcium DL-Pantothenate |
| UNII:2KC899R47Q |
| β-Alanine, N-(2,4-dihydroxy-3,3-dimethyl-1-oxobutyl)-, calcium salt (2:1) |
| DL-Pantothenic acid calcium salt |
| Calcium Pantothenate |
| MFCD00150718 |
| (±)-N-(2,4-Dihydroxy-3,3-dimethylbutyryl)-β-alanine |