4-(ethoxymethylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one structure
|
Common Name | 4-(ethoxymethylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 634148-61-1 | Molecular Weight | 231.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(ethoxymethylidene)-2-(4-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13NO3 |
|---|---|
| Molecular Weight | 231.24700 |
| Exact Mass | 231.09000 |
| PSA | 47.89000 |
| LogP | 1.61190 |
| InChIKey | KVPONSNRADDPRX-DHZHZOJOSA-N |
| SMILES | CCOC=C1N=C(c2ccc(C)cc2)OC1=O |
|
~%
4-(ethoxymethyl... CAS#:634148-61-1 |
| Literature: Jena,E.; Tripathy,P.B. Journal of the Indian Chemical Society, 1970 , vol. 47, p. 251 - 254 |
| 5(4H)-Oxazolone,4-(ethoxymethylene)-2-(4-methylphenyl) |
| 2-(p-Tolyl)-4-aethoxymethylen-oxazolon-(5) |
| 4-ethoxymethylene-2-p-tolyl-4H-oxazol-5-one |
| 4-ethoxymethylene-2-p-tolyl-5-azlactone |