N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide structure
|
Common Name | N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide | ||
|---|---|---|---|---|
| CAS Number | 6342-33-2 | Molecular Weight | 410.46600 | |
| Density | 1.159g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H26N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.46600 |
| Exact Mass | 410.19500 |
| PSA | 101.38000 |
| LogP | 3.64640 |
| Index of Refraction | 1.564 |
| InChIKey | WUMPLZWCADPTGU-FEZYOMQXSA-N |
| SMILES | COc1ccc(C=NN(N=Cc2ccc(OC)cc2)C(=O)CCCCC(N)=O)cc1 |
|
~%
N,N-bis[(4-meth... CAS#:6342-33-2 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1953 , p. 1358,1361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |