N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide
![N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide Structure](https://image.chemsrc.com/caspic/123/6342-33-2.png)
N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide structure
|
Common Name | N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide | ||
|---|---|---|---|---|
| CAS Number | 6342-33-2 | Molecular Weight | 410.46600 | |
| Density | 1.159g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H26N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N,N-bis[(4-methoxyphenyl)methylideneamino]hexanediamide (CAS: 6342-33-2, molecular formula: C22H26N4O4, molecular weight: 410.466) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.159g/cm3 |
|---|---|
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.46600 |
| Exact Mass | 410.19500 |
| PSA | 101.38000 |
| LogP | 3.64640 |
| Index of Refraction | 1.564 |
| InChIKey | WUMPLZWCADPTGU-FEZYOMQXSA-N |
| SMILES | COc1ccc(C=NN(N=Cc2ccc(OC)cc2)C(=O)CCCCC(N)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N,N-bis[(4-meth... CAS#:6342-33-2 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1953 , p. 1358,1361 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: Polar surface area (PSA) of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is 101.38000. |
| Q: What is the SMILES notation of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: SMILES notation of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is COc1ccc(C=NN(N=Cc2ccc(OC)cc2)C(=O)CCCCC(N)=O)cc1. |
| Q: What is the Chinese name of 6342-33-2? |
| A: Chinese name of 6342-33-2 is 6342-33-2. |
| Q: What is the LogP of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: LogP of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is 3.64640. |
| Q: What is the molecular weight of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: Molecular weight of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is 410.46600. |
| Q: What is the molecular formula of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: Molecular formula of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is C22H26N4O4. |
| Q: What is the CAS number of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: CAS number of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is 6342-33-2. |
| Q: What is the InChIKey of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: InChIKey of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is WUMPLZWCADPTGU-FEZYOMQXSA-N. |
| Q: What is the English name of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: The English name of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide is N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide. |
| Q: What are the upstream materials of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide? |
| A: Related upstream materials(CAS) of N',N'-bis[(4-methoxyphenyl)methylideneamino]hexanediamide: 123-11-5;1071-93-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |