(1-(ethoxycarbonyl)-2-oxocyclopentyl)acetic acid structure
|
Common Name | (1-(ethoxycarbonyl)-2-oxocyclopentyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6342-78-5 | Molecular Weight | 214.21500 | |
| Density | 1.26g/cm3 | Boiling Point | 371ºC at 760 mmHg | |
| Molecular Formula | C10H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.6ºC | |
| Name | 2-(1-ethoxycarbonyl-2-oxocyclopentyl)acetic acid |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 371ºC at 760 mmHg |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.21500 |
| Flash Point | 145.6ºC |
| Exact Mass | 214.08400 |
| PSA | 80.67000 |
| LogP | 0.76360 |
| Index of Refraction | 1.495 |
| InChIKey | JJTRRJRRBRCVSC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC(=O)O)CCCC1=O |
|
~%
(1-(ethoxycarbo... CAS#:6342-78-5 |
| Literature: Matovic, Radomir; Cekovic, Zivorad Gazzetta Chimica Italiana, 1997 , vol. 127, # 9 p. 483 - 488 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|