Benzoic acid,4-[[(4-nitrophenyl)sulfonyl]amino]- structure
|
Common Name | Benzoic acid,4-[[(4-nitrophenyl)sulfonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 63421-71-6 | Molecular Weight | 322.29300 | |
| Density | 1.588 g/cm3 | Boiling Point | 564.3ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
| Name | n-((4-nitrophenyl)sulfonyl)-1-(tert-butyloxycarbonyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.588 g/cm3 |
|---|---|
| Boiling Point | 564.3ºC at 760 mmHg |
| Molecular Formula | C13H10N2O6S |
| Molecular Weight | 322.29300 |
| Flash Point | 295.1ºC |
| Exact Mass | 322.02600 |
| PSA | 137.67000 |
| LogP | 3.77080 |
| Index of Refraction | 1.674 |
| InChIKey | YMLUDZUNRJGLJJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Benzoic acid,4-... CAS#:63421-71-6 |
| Literature: Magerlein; Weisblat Journal of the American Chemical Society, 1954 , vol. 76, p. 1702 |
|
~%
Benzoic acid,4-... CAS#:63421-71-6 |
| Literature: Kustova; Kuritsyn; Khripkova Russian Journal of General Chemistry, 2001 , vol. 71, # 4 p. 623 - 626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(4-nitro-benzenesulfonylamino)-benzoic acid |
| 4-(4-nitro-benzenesulfonyl)-piperazine-1-carboxylic acid tert-butyl ester |
| 4-(4-Nitro-benzolsulfonylamino)-benzoesaeure |