1,2-Benzisothiazol-3(2H)-one,2-(2-hydroxyethyl)-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazol-3(2H)-one,2-(2-hydroxyethyl)-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 6343-81-3 | Molecular Weight | 227.23700 | |
| Density | 1.538g/cm3 | Boiling Point | 454.2ºC at 760 mmHg | |
| Molecular Formula | C9H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 2-(2-hydroxyethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.538g/cm3 |
|---|---|
| Boiling Point | 454.2ºC at 760 mmHg |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.23700 |
| Flash Point | 228.5ºC |
| Exact Mass | 227.02500 |
| PSA | 83.06000 |
| LogP | 0.84210 |
| Index of Refraction | 1.635 |
| InChIKey | CJWAPCSQEWUZAE-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCO |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(2-hydroxyethyl)-1,2-benzisothiazol-3(2H)one-1,1-dioxide |
| N-(2-Hydroxyethyl)-o-sulfobenzimide |
| N-(2-Hydroxy-ethyl)-o-sulfo-benzimid |
| 2-(2-hydroxyethyl)-1,2-benzisothiazol-3(2H)-one 1,1-dioxide |
| 2-(2-hydroxyethyl)-1,2-benzothiazol-3(2h)-one 1,1-dioxide |