2,6,10,15,19,23-Hexamethyl-2,6,18,22-tetracosatetrene-10,15-diol structure
|
Common Name | 2,6,10,15,19,23-Hexamethyl-2,6,18,22-tetracosatetrene-10,15-diol | ||
|---|---|---|---|---|
| CAS Number | 63438-42-6 | Molecular Weight | 446.74900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H54O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6,10,15,19,23-hexamethyltetracosa-2,6,18,22-tetraene-10,15-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H54O2 |
|---|---|
| Molecular Weight | 446.74900 |
| Exact Mass | 446.41200 |
| PSA | 40.46000 |
| LogP | 8.99460 |
| InChIKey | UJLSKUQXMLFRSK-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)(O)CCCCC(C)(O)CCC=C(C)CCC=C(C)C |
| HS Code | 2905399090 |
|---|
|
~%
2,6,10,15,19,23... CAS#:63438-42-6 |
| Literature: Farmer; Sutton Journal of the Chemical Society, 1942 , p. 121 |
| HS Code | 2905399090 |
|---|---|
| Summary | 2905399090 other diols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,6,10,15,19,23-hexamethyl-tetracosa-2,6,18,22-tetraene-10,15-diol |
| 2,6,18,22-Tetracosatetraene-10,15-diol,2,6,10,15,19,23-hexamethyl |
| Dihydroxy-tetrahydrosqualen |
| 2,6,10,15,19,23-Hexamethyl-tetracosa-2,6,18,22-tetraen-10,15-diol |