1,5-dimethyl-2-phenylpyrazol-3-one,ethyl 4-aminobenzoate structure
|
Common Name | 1,5-dimethyl-2-phenylpyrazol-3-one,ethyl 4-aminobenzoate | ||
|---|---|---|---|---|
| CAS Number | 63448-01-1 | Molecular Weight | 353.41500 | |
| Density | N/A | Boiling Point | 319ºC at 760 mmHg | |
| Molecular Formula | C20H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 1,5-dimethyl-2-phenylpyrazol-3-one,ethyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 319ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.41500 |
| Flash Point | 114.8ºC |
| Exact Mass | 353.17400 |
| PSA | 79.25000 |
| LogP | 3.51110 |
| InChIKey | ZTAKXWLTKDPLJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N)cc1.Cc1cc(=O)n(-c2ccccc2)n1C |
| Benzoic acid,4-amino-,ethyl ester,mixt. with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
| Benzocaine mixture with antipyrine |
| Auroguard Otic |
| Auroguard |