Acetic acid,2-[(3-acetylphenyl)amino]-2-oxo-, ethyl ester structure
|
Common Name | Acetic acid,2-[(3-acetylphenyl)amino]-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6345-11-5 | Molecular Weight | 235.23600 | |
| Density | 1.234g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(3-acetylanilino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Exact Mass | 235.08400 |
| PSA | 72.47000 |
| LogP | 1.46380 |
| Index of Refraction | 1.559 |
| InChIKey | UJBNBLTXDRBMDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1cccc(C(C)=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Acetyl-oxanilsaeure-aethylester |
| Aethyl-3'-acetyloxanilat |