1H-Inden-1-one,3-hydroxy-2-(2-pyridinyl)- structure
|
Common Name | 1H-Inden-1-one,3-hydroxy-2-(2-pyridinyl)- | ||
|---|---|---|---|---|
| CAS Number | 6345-69-3 | Molecular Weight | 223.22700 | |
| Density | 1.365g/cm3 | Boiling Point | 420.5ºC at 760 mmHg | |
| Molecular Formula | C14H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.2ºC | |
| Name | N-[4-(thiophene-2-carbonylcarbamothioylamino)phenyl]furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760 mmHg |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.22700 |
| Flash Point | 181.2ºC |
| Exact Mass | 223.06300 |
| PSA | 50.19000 |
| LogP | 2.70420 |
| Index of Refraction | 1.682 |
| InChIKey | HDCMQOAMCVCDEM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(NC(=S)NC(=O)c2cccs2)cc1)c1ccco1 |
| HS Code | 2933399090 |
|---|
|
~45%
1H-Inden-1-one,... CAS#:6345-69-3 |
| Literature: Stadlbauer, Wolfgang; Fischer, Michaela Journal of Heterocyclic Chemistry, 2002 , vol. 39, # 1 p. 131 - 135 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2731E10 |
| Pyrophthalon |