3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one
3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one structure
|
Common Name | 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one | ||
|---|---|---|---|---|
| CAS Number | 6345-76-2 | Molecular Weight | 331.36500 | |
| Density | 1.294g/cm3 | Boiling Point | 515.8ºC at 760 mmHg | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 515.8ºC at 760 mmHg |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.36500 |
| Flash Point | 265.7ºC |
| Exact Mass | 331.12100 |
| PSA | 59.42000 |
| LogP | 3.30620 |
| Index of Refraction | 1.652 |
| InChIKey | WVOCIRPVBTVUAP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(O)c3ccccc3C(=O)C2c2ccccn2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-hydroxy-3-(4-... CAS#:6345-76-2 |
| Literature: Manly et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 373,377 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: CAS number of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is 6345-76-2. |
| Q: What are the upstream materials of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: Related upstream materials(CAS) of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one: 63542-24-5;14774-77-7. |
| Q: What is the SMILES notation of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: SMILES notation of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is COc1ccc(C2(O)c3ccccc3C(=O)C2c2ccccn2)cc1. |
| Q: What is the boiling point of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: Boiling point of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is 515.8ºC at 760 mmHg. |
| Q: What is the InChIKey of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: InChIKey of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is WVOCIRPVBTVUAP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: Polar surface area (PSA) of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is 59.42000. |
| Q: What is the molecular weight of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: Molecular weight of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is 331.36500. |
| Q: What is the Chinese name of 6345-76-2? |
| A: Chinese name of 6345-76-2 is 6345-76-2. |
| Q: What is the molecular formula of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: Molecular formula of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is C21H17NO3. |
| Q: What is the English name of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one? |
| A: The English name of 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one is 3-hydroxy-3-(4-methoxyphenyl)-2-pyridin-2-yl-2H-inden-1-one. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |