4-methoxy-N-phenethyl-benzamide structure
|
Common Name | 4-methoxy-N-phenethyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 6346-07-2 | Molecular Weight | 255.31200 | |
| Density | 1.105g/cm3 | Boiling Point | 452.9ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 4-methoxy-N-(2-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760 mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 227.7ºC |
| Exact Mass | 255.12600 |
| PSA | 38.33000 |
| LogP | 3.05860 |
| Index of Refraction | 1.568 |
| InChIKey | WUIBKBDHYVOURV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NCCc2ccccc2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Inhibition of microRNA miR-21 expression in human HeLa cells assessed as reduction of...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3743769
|
| 4-Methoxy-N-phenethyl-benzamide |
| N-phenethyl-4-methoxybenzamide |