5-(2,5-dimethoxyphenyl)-5-oxo-pentanoic acid structure
|
Common Name | 5-(2,5-dimethoxyphenyl)-5-oxo-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 63467-20-9 | Molecular Weight | 252.26300 | |
| Density | 1.183g/cm3 | Boiling Point | 448.3ºC at 760 mmHg | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | 5-(2,5-dimethoxyphenyl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 448.3ºC at 760 mmHg |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.26300 |
| Flash Point | 170.6ºC |
| Exact Mass | 252.10000 |
| PSA | 72.83000 |
| LogP | 2.14140 |
| Index of Refraction | 1.522 |
| InChIKey | LZYOLLXPXIINET-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)CCCC(=O)O)c1 |
| HS Code | 2918990090 |
|---|
|
~%
5-(2,5-dimethox... CAS#:63467-20-9 |
| Literature: Journal of the University of Bombay, Science: Physical Sciences, Mathematics, Biological Sciences and Medicine, , vol. 15/5 A, p. 19 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(2,5-Dimethoxy-phenyl)-5-oxo-valeriansaeure |
| 5-(2,5-dimethoxyphenyl)-5-ketopentanoic acid |
| 5-(2,5-DIMETHOXYPHENYL)-5-OXOVALERIC ACID |