p-phenylenebis[dithiocarbamic] acid, compound with triethylamine (1:2) structure
|
Common Name | p-phenylenebis[dithiocarbamic] acid, compound with triethylamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 63468-86-0 | Molecular Weight | 462.80300 | |
| Density | N/A | Boiling Point | 369.5ºC at 760 mmHg | |
| Molecular Formula | C20H38N4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | N,N-diethylethanamine,[4-(dithiocarboxyamino)phenyl]carbamodithioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 369.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H38N4S4 |
| Molecular Weight | 462.80300 |
| Flash Point | 177.3ºC |
| Exact Mass | 462.19800 |
| PSA | 172.32000 |
| LogP | 5.78200 |
| InChIKey | OCMBLTPYYSSZIB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.CCN(CC)CC.S=C(S)Nc1ccc(NC(=S)S)cc1 |
| [4-(dithiocarboxyamino)phenyl]carbamodithioic acid |
| p-Phenylenebis(dithiocarbamic) acid,compound with triethylamine (1:2) |
| Carbamodithioic acid,N,N'-1,4-phenylenebis-,compd. with N,N-diethylethanamine (1:2) |
| Carbamodithioic acid,1,4-phenylenebis-,compd. with N,N-diethylethanamine (1:2) |
| EINECS 264-257-2 |