3-(4-Phenylphenoxy)propanoic acid structure
|
Common Name | 3-(4-Phenylphenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 63472-21-9 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-([1,1'-biphenyl]-4-yloxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 3.20710 |
| InChIKey | SJVZXSPIOGTQLX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOc1ccc(-c2ccccc2)cc1 |
|
~%
3-(4-Phenylphen... CAS#:63472-21-9 |
| Literature: Loudon; Razdan Journal of the Chemical Society, 1954 , p. 4299,4301 |
| 3-biphenyl-4-yloxy-propionic acid |
| 3-Biphenyl-4-yloxy-propionsaeure |
| p-Biphenyl-propionsaeure-aether |