7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione structure
|
Common Name | 7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione | ||
|---|---|---|---|---|
| CAS Number | 63480-11-5 | Molecular Weight | 177.157 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-methyl-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.157 |
| Exact Mass | 177.042587 |
| PSA | 63.07000 |
| LogP | 1.37 |
| Index of Refraction | 1.576 |
| InChIKey | FTOHSJGKIFDLQU-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(=O)oc(=O)[nH]c2c1 |
| HS Code | 2934999090 |
|---|
|
~%
7-Methyl-2H-3,1... CAS#:63480-11-5 |
| Literature: Chemical Biology and Drug Design, , vol. 75, # 5 p. 444 - 454 |
|
~%
7-Methyl-2H-3,1... CAS#:63480-11-5 |
| Literature: Chemische Berichte, , vol. 42, p. 2110 |
|
~%
7-Methyl-2H-3,1... CAS#:63480-11-5 |
| Literature: Chemische Berichte, , vol. 42, p. 2110 |
|
~%
7-Methyl-2H-3,1... CAS#:63480-11-5 |
| Literature: Chemische Berichte, , vol. 22, p. 1673,1674 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methyl-1H-benz[d][1,3]oxazin-2,4-dion |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 7-methyl- |
| 7-methyl-1H-benzo[d][1,3]oxazine-2,4-dione |
| 7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione |
| 4-Methyl-isatoic anhydride |
| 7-methyl-1H-benz[d][1,3]oxazine-2,4-dione |
| 4-Methyl-isatoicanhydride |
| 7-methyl-1-H-benzo[d][1,3]oxazine-2,4-dione |