3-Hydroxy-11-methylheptadecanoic acid 3-(3-hydroxy-4,5-dimethoxyphenyl)propyl ester structure
|
Common Name | 3-Hydroxy-11-methylheptadecanoic acid 3-(3-hydroxy-4,5-dimethoxyphenyl)propyl ester | ||
|---|---|---|---|---|
| CAS Number | 63543-07-7 | Molecular Weight | 494.70400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H50O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Schkuhrianol |
|---|
| Molecular Formula | C29H50O6 |
|---|---|
| Molecular Weight | 494.70400 |
| Exact Mass | 494.36100 |
| PSA | 85.22000 |
| LogP | 6.97340 |
| InChIKey | YVAXZNKKSLAKDG-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)CCCCCCCC(O)CC(=O)OCCCc1cc(O)c(OC)c(OC)c1 |
| HS Code | 2918199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |