8-amino-5-(4-hydroxyphenylamino)naphthalene-2-sulfonicacid
Modify Date: 2024-09-14 23:50:44
8-amino-5-(4-hydroxyphenylamino)naphthalene-2-sulfonicacid structure
|
Common Name | 8-amino-5-(4-hydroxyphenylamino)naphthalene-2-sulfonicacid | ||
|---|---|---|---|---|
| CAS Number | 6357-75-1 | Molecular Weight | 330.35800 | |
| Density | 1.55g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Amino-5-[(4-hydroxyphenyl)amino]-2-naphthalenesulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.35800 |
| Exact Mass | 330.06700 |
| PSA | 121.03000 |
| LogP | 4.85290 |
| Index of Refraction | 1.765 |
| InChIKey | CAUOCGDGBOJRSS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Nc2ccc(O)cc2)c2ccc(S(=O)(=O)O)cc12 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 8-amino-5-(4-hydroxyanilino)naphthalene-2-sulfonic acid |