8-amino-5-nitronaphthalene-2-sulfonic acid
8-amino-5-nitronaphthalene-2-sulfonic acid structure
|
Common Name | 8-amino-5-nitronaphthalene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-78-4 | Molecular Weight | 268.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-amino-5-nitronaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8N2O5S |
|---|---|
| Molecular Weight | 268.24600 |
| Exact Mass | 268.01500 |
| PSA | 134.59000 |
| LogP | 3.76210 |
| InChIKey | MYQSCJGSZROJFZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c2ccc(S(=O)(=O)O)cc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2921450090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
8-amino-5-nitro... CAS#:6357-78-4 |
| Literature: Cassella Patent: DE73502 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 511 |
|
~%
8-amino-5-nitro... CAS#:6357-78-4 |
| Literature: Cassella and Co. Patent: DE73502 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 511 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 8-Amino-5-nitro-naphthalin-2-sulfonsaeure |
| 8-amino-5-nitro-naphthalene-2-sulfonic acid |
| 4-Nitro-naphthylamin-(1)-sulfonsaeure-(7) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: Molecular weight of 8-amino-5-nitronaphthalene-2-sulfonic acid is 268.24600. |
| Q: What English synonyms does 8-amino-5-nitronaphthalene-2-sulfonic acid have? |
| A: English synonyms of 8-amino-5-nitronaphthalene-2-sulfonic acid: 8-Amino-5-nitro-naphthalin-2-sulfonsaeure, 8-amino-5-nitro-naphthalene-2-sulfonic acid, 4-Nitro-naphthylamin-(1)-sulfonsaeure-(7). |
| Q: What is the CAS number of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: CAS number of 8-amino-5-nitronaphthalene-2-sulfonic acid is 6357-78-4. |
| Q: What is the SMILES notation of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: SMILES notation of 8-amino-5-nitronaphthalene-2-sulfonic acid is Nc1ccc([N+](=O)[O-])c2ccc(S(=O)(=O)O)cc12. |
| Q: What is the polar surface area (PSA) of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: Polar surface area (PSA) of 8-amino-5-nitronaphthalene-2-sulfonic acid is 134.59000. |
| Q: What are the upstream materials of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: Related upstream materials(CAS) of 8-amino-5-nitronaphthalene-2-sulfonic acid: 119-28-8;7664-93-9. |
| Q: What is the InChIKey of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: InChIKey of 8-amino-5-nitronaphthalene-2-sulfonic acid is MYQSCJGSZROJFZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: Molecular formula of 8-amino-5-nitronaphthalene-2-sulfonic acid is C10H8N2O5S. |
| Q: What is the English name of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: The English name of 8-amino-5-nitronaphthalene-2-sulfonic acid is 8-amino-5-nitronaphthalene-2-sulfonic acid. |
| Q: What is the LogP of 8-amino-5-nitronaphthalene-2-sulfonic acid? |
| A: LogP of 8-amino-5-nitronaphthalene-2-sulfonic acid is 3.76210. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |