8-amino-5-nitronaphthalene-2-sulfonic acid structure
|
Common Name | 8-amino-5-nitronaphthalene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-78-4 | Molecular Weight | 268.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-amino-5-nitronaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O5S |
|---|---|
| Molecular Weight | 268.24600 |
| Exact Mass | 268.01500 |
| PSA | 134.59000 |
| LogP | 3.76210 |
| InChIKey | MYQSCJGSZROJFZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c2ccc(S(=O)(=O)O)cc12 |
| HS Code | 2921450090 |
|---|
|
~%
8-amino-5-nitro... CAS#:6357-78-4 |
| Literature: Cassella Patent: DE73502 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 511 |
|
~%
8-amino-5-nitro... CAS#:6357-78-4 |
| Literature: Cassella and Co. Patent: DE73502 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 511 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 8-Amino-5-nitro-naphthalin-2-sulfonsaeure |
| 8-amino-5-nitro-naphthalene-2-sulfonic acid |
| 4-Nitro-naphthylamin-(1)-sulfonsaeure-(7) |