8-(4-methylanilino)-1-naphthol-5-sulfonic acid structure
|
Common Name | 8-(4-methylanilino)-1-naphthol-5-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-83-1 | Molecular Weight | 329.37000 | |
| Density | 1.15g/cm3 | Boiling Point | 544.4ºC at 760 mmHg | |
| Molecular Formula | C17H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283ºC | |
| Name | 8-(4-methylanilino)-1-naphthol-5-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 544.4ºC at 760 mmHg |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.37000 |
| Flash Point | 283ºC |
| Exact Mass | 329.07200 |
| PSA | 95.01000 |
| LogP | 4.99790 |
| Index of Refraction | 1.569 |
| InChIKey | SOAOYQPQSTXKJB-UHFFFAOYSA-N |
| SMILES | CC1CCc2c(sc(NC(=O)CCC3CCCCC3)c2C#N)C1 |
| HS Code | 2922199090 |
|---|
|
~%
8-(4-methylanil... CAS#:6357-83-1 |
| Literature: Bayer and Co. Patent: DE181929 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentanal,5-hydroxy-4-oxo |
| 5-hydroxy-4-p-toluidino-naphthalene-1-sulfonic acid |
| 8-p-Toluidino-naphthol-(1)-sulfonsaeure-(5) |
| 5-hydroxy-4-oxo-pentanal |
| 5-Hydroxy-4-p-toluidino-naphthalin-1-sulfonsaeure |