3-hydroxynaphthalenesulphonic acid
3-hydroxynaphthalenesulphonic acid structure
|
Common Name | 3-hydroxynaphthalenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-85-3 | Molecular Weight | 224.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hydroxy-1-Naphthalenesulfonicacid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8O4S |
|---|---|
| Molecular Weight | 224.23 |
| Exact Mass | 224.01432991 |
| PSA | 109.41000 |
| LogP | 4.50300 |
| InChIKey | RZMZJYAMZGWBLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=C2S(=O)(=O)O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2908999090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:118-90-1
CAS#:64-19-7
CAS#:116-63-2
CAS#:2198-75-6
CAS#:85895-99-4
CAS#:573-64-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: Related downstream products(CAS) of 3-hydroxy-1-Naphthalenesulfonicacid: 118-90-1;64-19-7;116-63-2;2198-75-6;85895-99-4;573-64-8. |
| Q: What is the molecular weight of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: Molecular weight of 3-hydroxy-1-Naphthalenesulfonicacid is 224.23. |
| Q: What is the InChIKey of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: InChIKey of 3-hydroxy-1-Naphthalenesulfonicacid is RZMZJYAMZGWBLB-UHFFFAOYSA-N. |
| Q: What is the English name of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: The English name of 3-hydroxy-1-Naphthalenesulfonicacid is 3-hydroxy-1-Naphthalenesulfonicacid. |
| Q: What is the LogP of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: LogP of 3-hydroxy-1-Naphthalenesulfonicacid is 4.50300. |
| Q: What is the molecular formula of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: Molecular formula of 3-hydroxy-1-Naphthalenesulfonicacid is C10H8O4S. |
| Q: What is the Chinese name of 6357-85-3? |
| A: Chinese name of 6357-85-3 is 6357-85-3. |
| Q: What is the polar surface area (PSA) of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: Polar surface area (PSA) of 3-hydroxy-1-Naphthalenesulfonicacid is 109.41000. |
| Q: What is the SMILES notation of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: SMILES notation of 3-hydroxy-1-Naphthalenesulfonicacid is C1=CC=C2C(=C1)C=C(C=C2S(=O)(=O)O)O. |
| Q: What is the CAS number of 3-hydroxy-1-Naphthalenesulfonicacid? |
| A: CAS number of 3-hydroxy-1-Naphthalenesulfonicacid is 6357-85-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |