6-(2,4-diaminophenoxy)-2-naphthalenesulfonic acid structure
|
Common Name | 6-(2,4-diaminophenoxy)-2-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-92-2 | Molecular Weight | 330.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2,4-diaminophenoxy)naphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2O4S |
|---|---|
| Molecular Weight | 330.35800 |
| Exact Mass | 330.06700 |
| PSA | 124.02000 |
| LogP | 5.28640 |
| InChIKey | RYTNBKZCNDXASE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc3cc(S(=O)(=O)O)ccc3c2)c(N)c1 |
| HS Code | 2922299090 |
|---|
|
~%
6-(2,4-diaminop... CAS#:6357-92-2 |
| Literature: Cassella and Co. Patent: DE187150 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-(2,4-DIAMINOPHENOXY)-2-NAPHTHALENESULFONIC ACID |
| 6-(2,4-Diamino-phenoxy)-naphthalin-2-sulfonsaeure |
| 6-(2,4-diamino-phenoxy)-naphthalene-2-sulfonic acid |