2-(3-methyl-5-phenyl-pyrazol-1-yl)-1,2-diphenyl-ethanone structure
|
Common Name | 2-(3-methyl-5-phenyl-pyrazol-1-yl)-1,2-diphenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 63570-09-2 | Molecular Weight | 352.42800 | |
| Density | 1.11g/cm3 | Boiling Point | 541.7ºC at 760 mmHg | |
| Molecular Formula | C24H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methyl-5-phenylpyrazol-1-yl)-1,2-diphenylethanone |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 541.7ºC at 760 mmHg |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.42800 |
| Exact Mass | 352.15800 |
| PSA | 34.89000 |
| LogP | 5.33080 |
| Index of Refraction | 1.615 |
| InChIKey | MZYGWTXNDWIMNK-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)n(C(C(=O)c2ccccc2)c2ccccc2)n1 |
|
~99%
2-(3-methyl-5-p... CAS#:63570-09-2 |
| Literature: Schweizer, Edward E.; Lee, Kee-Jung Journal of Organic Chemistry, 1982 , vol. 47, # 14 p. 2768 - 2773 |
|
~98%
2-(3-methyl-5-p... CAS#:63570-09-2 |
| Literature: Schweizer, Edward E.; Lee, Kee-Jung Journal of Organic Chemistry, 1982 , vol. 47, # 14 p. 2768 - 2773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |