4,6-O-Benzylidene-D-glucal structure
|
Common Name | 4,6-O-Benzylidene-D-glucal | ||
|---|---|---|---|---|
| CAS Number | 63598-36-7 | Molecular Weight | 234.24800 | |
| Density | 1.259g/cm3 | Boiling Point | 420.9ºC at 760 mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | 138-143ºC | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | 4,6-O-Benzylidene-D-glucal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760 mmHg |
| Melting Point | 138-143ºC |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 208.3ºC |
| Exact Mass | 234.08900 |
| PSA | 47.92000 |
| LogP | 1.37400 |
| Index of Refraction | 1.567 |
| InChIKey | XMDUTBYCCVWPLD-FKJOKYEKSA-N |
| SMILES | OC1C=COC2COC(c3ccccc3)OC12 |
| Storage condition | -20°C Freezer |
| HS Code | 2932999099 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| 4,6-o-benzylidene-d-glucal |