(9-bromo-9H-fluoren-2-yl)-phenylmethanone structure
|
Common Name | (9-bromo-9H-fluoren-2-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 63610-04-8 | Molecular Weight | 349.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (9-bromo-9H-fluoren-2-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H13BrO |
|---|---|
| Molecular Weight | 349.22100 |
| Exact Mass | 348.01500 |
| PSA | 17.07000 |
| LogP | 5.38230 |
| InChIKey | BQXBVOCMJMOZSN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)C(Br)c1ccccc1-2 |
|
~82%
(9-bromo-9H-flu... CAS#:63610-04-8 |
| Literature: Jemison, Robert W.; Ollis, W. David; Sutherland, Ian O.; Tannock, James Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1462 - 1472 |
| 2-benzoyl-9-bromofluorene |
| 9-Brom-2-benzoylfluoren |