1-[methyl(propan-2-yl)amino]-3-(2-phenylphenoxy)propan-2-ol structure
|
Common Name | 1-[methyl(propan-2-yl)amino]-3-(2-phenylphenoxy)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 63638-03-9 | Molecular Weight | 299.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[methyl(propan-2-yl)amino]-3-(2-phenylphenoxy)propan-2-ol |
|---|
| Molecular Formula | C19H25NO2 |
|---|---|
| Molecular Weight | 299.40700 |
| Exact Mass | 299.18900 |
| PSA | 32.70000 |
| LogP | 3.43350 |
| InChIKey | FYZYEKROTXFXCR-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)CC(O)COc1ccccc1-c1ccccc1 |
|
~%
1-[methyl(propa... CAS#:63638-03-9 |
| Literature: The Regents of the University of Michigan Patent: US4241088 A1, 1980 ; US 4241088 A |