(R)-2-(4-Chlorophenyl)-3-methylbutanoic acid
Modify Date: 2025-08-25 12:20:38
(R)-2-(4-Chlorophenyl)-3-methylbutanoic acid structure
|
Common Name | (R)-2-(4-Chlorophenyl)-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 63640-09-5 | Molecular Weight | 212.67300 | |
| Density | 1.184g/cm3 | Boiling Point | 318.7ºC at 760 mmHg | |
| Molecular Formula | C11H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.5ºC | |
| Name | (R)-2-(4-Chlorophenyl)-3-methylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.184g/cm3 |
|---|---|
| Boiling Point | 318.7ºC at 760 mmHg |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.67300 |
| Flash Point | 146.5ºC |
| Exact Mass | 212.06000 |
| PSA | 37.30000 |
| LogP | 3.16420 |
| Index of Refraction | 1.537 |
| InChIKey | VTJMSIIXXKNIDJ-SNVBAGLBSA-N |
| SMILES | CC(C)C(C(=O)O)c1ccc(Cl)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:67614-33-9| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2R)-2-(4-chlorophenyl)-3-methylbutanoic acid |