dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate
dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate structure
|
Common Name | dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 63646-67-3 | Molecular Weight | 248.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20O6 |
|---|---|
| Molecular Weight | 248.27300 |
| Exact Mass | 248.12600 |
| PSA | 71.06000 |
| LogP | 0.59370 |
| InChIKey | CSNATMIOTXWDTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)C(C)(C)C(OC)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
dimethyl 2-(1,1... CAS#:63646-67-3 |
| Literature: Verhe, R.; De Kimpe, N.; De Buyck, L.; Courtheyn, D.; Caenegem, L. Van; Schamp, N. Bulletin des Societes Chimiques Belges, 1983 , vol. 92, # 4 p. 371 - 396 |
|
~65%
dimethyl 2-(1,1... CAS#:63646-67-3 |
| Literature: Verhe, R.; De Kimpe, N.; De Buyck, L.; Courtheyn, D.; Caenegem, L. Van; Schamp, N. Bulletin des Societes Chimiques Belges, 1983 , vol. 92, # 4 p. 371 - 396 |
|
~%
dimethyl 2-(1,1... CAS#:63646-67-3 |
| Literature: Verhe,R. et al. Bulletin des Societes Chimiques Belges, 1977 , vol. 86, p. 55 - 63 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dimethyl-2.2-dimethoxy-1.1-dimethylaethylmalonat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: Polar surface area (PSA) of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is 71.06000. |
| Q: What is the SMILES notation of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: SMILES notation of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is COC(=O)C(C(=O)OC)C(C)(C)C(OC)OC. |
| Q: What is the InChIKey of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: InChIKey of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is CSNATMIOTXWDTI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 63646-67-3? |
| A: Chinese name of 63646-67-3 is 63646-67-3. |
| Q: What is the LogP of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: LogP of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is 0.59370. |
| Q: What is the molecular formula of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: Molecular formula of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is C11H20O6. |
| Q: What is the English name of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: The English name of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate. |
| Q: What is the CAS number of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: CAS number of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is 63646-67-3. |
| Q: What English synonyms does dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate have? |
| A: English synonyms of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate: Dimethyl-2.2-dimethoxy-1.1-dimethylaethylmalonat. |
| Q: What is the molecular weight of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate? |
| A: Molecular weight of dimethyl 2-(1,1-dimethoxy-2-methylpropan-2-yl)propanedioate is 248.27300. |