(S)-2-Acetamido-3-(1H-imidazol-4-yl)-N-methylpropanamide
(S)-2-Acetamido-3-(1H-imidazol-4-yl)-N-methylpropanamide structure
|
Common Name | (S)-2-Acetamido-3-(1H-imidazol-4-yl)-N-methylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 6367-11-9 | Molecular Weight | 210.23300 | |
| Density | 1.221g/cm3 | Boiling Point | 681.4ºC at 760 mmHg | |
| Molecular Formula | C9H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Acetyl-L-histidine Methylamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 681.4ºC at 760 mmHg |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.23300 |
| Flash Point | 365.9ºC |
| Exact Mass | 210.11200 |
| PSA | 86.88000 |
| Index of Refraction | 1.54 |
| InChIKey | XWLRQKZOVSBKSE-QMMMGPOBSA-N |
| SMILES | CNC(=O)C(Cc1cnc[nH]1)NC(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(S)-2-Acetamido... CAS#:6367-11-9 |
| Literature: Applewhite; Niemann Journal of the American Chemical Society, 1959 , vol. 81, p. 2208,2213 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2S)-2-acetamido-3-(1H-imidazol-5-yl)-N-methylpropanamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-Acetyl-L-histidine Methylamide? |
| A: The English name of N-Acetyl-L-histidine Methylamide is N-Acetyl-L-histidine Methylamide. |
| Q: What is the molecular formula of N-Acetyl-L-histidine Methylamide? |
| A: Molecular formula of N-Acetyl-L-histidine Methylamide is C9H14N4O2. |
| Q: What is the molecular weight of N-Acetyl-L-histidine Methylamide? |
| A: Molecular weight of N-Acetyl-L-histidine Methylamide is 210.23300. |
| Q: What is the CAS number of N-Acetyl-L-histidine Methylamide? |
| A: CAS number of N-Acetyl-L-histidine Methylamide is 6367-11-9. |
| Q: What is the InChIKey of N-Acetyl-L-histidine Methylamide? |
| A: InChIKey of N-Acetyl-L-histidine Methylamide is XWLRQKZOVSBKSE-QMMMGPOBSA-N. |
| Q: What is the polar surface area (PSA) of N-Acetyl-L-histidine Methylamide? |
| A: Polar surface area (PSA) of N-Acetyl-L-histidine Methylamide is 86.88000. |
| Q: What is the SMILES notation of N-Acetyl-L-histidine Methylamide? |
| A: SMILES notation of N-Acetyl-L-histidine Methylamide is CNC(=O)C(Cc1cnc[nH]1)NC(C)=O. |
| Q: What is the boiling point of N-Acetyl-L-histidine Methylamide? |
| A: Boiling point of N-Acetyl-L-histidine Methylamide is 681.4ºC at 760 mmHg. |
| Q: What are the upstream materials of N-Acetyl-L-histidine Methylamide? |
| A: Related upstream materials(CAS) of N-Acetyl-L-histidine Methylamide: 2497-02-1. |
| Q: What English synonyms does N-Acetyl-L-histidine Methylamide have? |
| A: English synonyms of N-Acetyl-L-histidine Methylamide: (2S)-2-acetamido-3-(1H-imidazol-5-yl)-N-methylpropanamide. |